C7H13ClN2O — CID 106437480
3-[(3-chloro-2-methylprop-2-enyl)amino]propanamide (PubChem CID 106437480) has the molecular formula C7H13ClN2O and a molecular weight of 176.65 g/mol. Its IUPAC name is 3-[(3-chloro-2-methylprop-2-enyl)amino]propanamide.
| Compound Name | 3-[(3-chloro-2-methylprop-2-enyl)amino]propanamide |
|---|---|
| PubChem CID | 106437480 |
| Molecular Formula | C7H13ClN2O |
| Molecular Weight | 176.65 g/mol |
| Exact Mass | 176.07 |
| IUPAC Name | 3-[(3-chloro-2-methylprop-2-enyl)amino]propanamide |
| SMILES | CC(=CCl)CNCCC(N)=O |
| InChI | InChI=1S/C7H13ClN2O/c1-6(4-8)5-10-3-2-7(9)11/h4,10H,2-3,5H2,1H3,(H2,9,11) |
| InChIKey | ZPRBZLIMJQXUQL-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.65 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|