C9H19N3O2 — CID 43553529
3-[[2-[methyl(propan-2-yl)amino]-2-oxoethyl]amino]propanamide (PubChem CID 43553529) has the molecular formula C9H19N3O2 and a molecular weight of 201.27 g/mol. Its IUPAC name is 3-[[2-[methyl(propan-2-yl)amino]-2-oxoethyl]amino]propanamide.
| Compound Name | 3-[[2-[methyl(propan-2-yl)amino]-2-oxoethyl]amino]propanamide |
|---|---|
| PubChem CID | 43553529 |
| Molecular Formula | C9H19N3O2 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | 3-[[2-[methyl(propan-2-yl)amino]-2-oxoethyl]amino]propanamide |
| SMILES | CC(C)N(C)C(=O)CNCCC(N)=O |
| InChI | InChI=1S/C9H19N3O2/c1-7(2)12(3)9(14)6-11-5-4-8(10)13/h7,11H,4-6H2,1-3H3,(H2,10,13) |
| InChIKey | XOVINVKLSFJGES-UHFFFAOYSA-N |
| XLogP | -0.68 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | -0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|