C11H19ClN2 — CID 106437648
N-(3-chloro-2-methylprop-2-enyl)-1-cyclopropylpyrrolidin-3-amine (PubChem CID 106437648) has the molecular formula C11H19ClN2 and a molecular weight of 214.74 g/mol. Its IUPAC name is N-(3-chloro-2-methylprop-2-enyl)-1-cyclopropylpyrrolidin-3-amine.
| Compound Name | N-(3-chloro-2-methylprop-2-enyl)-1-cyclopropylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 106437648 |
| Molecular Formula | C11H19ClN2 |
| Molecular Weight | 214.74 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | N-(3-chloro-2-methylprop-2-enyl)-1-cyclopropylpyrrolidin-3-amine |
| SMILES | CC(=CCl)CNC1CCN(C2CC2)C1 |
| InChI | InChI=1S/C11H19ClN2/c1-9(6-12)7-13-10-4-5-14(8-10)11-2-3-11/h6,10-11,13H,2-5,7-8H2,1H3 |
| InChIKey | QNBZEHJPBMRCHP-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.74 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |