C10H19ClN2O2S — CID 106437494
N-(3-chloro-2-methylprop-2-enyl)-1-methylsulfonylpiperidin-4-amine (PubChem CID 106437494) has the molecular formula C10H19ClN2O2S and a molecular weight of 266.79 g/mol. Its IUPAC name is N-(3-chloro-2-methylprop-2-enyl)-1-methylsulfonylpiperidin-4-amine.
| Compound Name | N-(3-chloro-2-methylprop-2-enyl)-1-methylsulfonylpiperidin-4-amine |
|---|---|
| PubChem CID | 106437494 |
| Molecular Formula | C10H19ClN2O2S |
| Molecular Weight | 266.79 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | N-(3-chloro-2-methylprop-2-enyl)-1-methylsulfonylpiperidin-4-amine |
| SMILES | CC(=CCl)CNC1CCN(S(C)(=O)=O)CC1 |
| InChI | InChI=1S/C10H19ClN2O2S/c1-9(7-11)8-12-10-3-5-13(6-4-10)16(2,14)15/h7,10,12H,3-6,8H2,1-2H3 |
| InChIKey | YKIWYAYZOIFYCJ-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.79 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |