C9H16ClNS — CID 106438186
3-chloro-2-methyl-N-(thiolan-3-ylmethyl)prop-2-en-1-amine (PubChem CID 106438186) has the molecular formula C9H16ClNS and a molecular weight of 205.75 g/mol. Its IUPAC name is 3-chloro-2-methyl-N-(thiolan-3-ylmethyl)prop-2-en-1-amine.
| Compound Name | 3-chloro-2-methyl-N-(thiolan-3-ylmethyl)prop-2-en-1-amine |
|---|---|
| PubChem CID | 106438186 |
| Molecular Formula | C9H16ClNS |
| Molecular Weight | 205.75 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | 3-chloro-2-methyl-N-(thiolan-3-ylmethyl)prop-2-en-1-amine |
| SMILES | CC(=CCl)CNCC1CCSC1 |
| InChI | InChI=1S/C9H16ClNS/c1-8(4-10)5-11-6-9-2-3-12-7-9/h4,9,11H,2-3,5-7H2,1H3 |
| InChIKey | BCDUIEDBUUOYNN-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.75 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |