C11H20ClN — CID 106438249
3-chloro-N-[(1-ethylcyclobutyl)methyl]-2-methylprop-2-en-1-amine (PubChem CID 106438249) has the molecular formula C11H20ClN and a molecular weight of 201.74 g/mol. Its IUPAC name is 3-chloro-N-[(1-ethylcyclobutyl)methyl]-2-methylprop-2-en-1-amine.
| Compound Name | 3-chloro-N-[(1-ethylcyclobutyl)methyl]-2-methylprop-2-en-1-amine |
|---|---|
| PubChem CID | 106438249 |
| Molecular Formula | C11H20ClN |
| Molecular Weight | 201.74 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | 3-chloro-N-[(1-ethylcyclobutyl)methyl]-2-methylprop-2-en-1-amine |
| SMILES | CCC1(CNCC(C)=CCl)CCC1 |
| InChI | InChI=1S/C11H20ClN/c1-3-11(5-4-6-11)9-13-8-10(2)7-12/h7,13H,3-6,8-9H2,1-2H3 |
| InChIKey | XFUQDAPTBHLIQC-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.74 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |