C8H14ClF2NO — CID 106438286
3-chloro-N-[2-(2,2-difluoroethoxy)ethyl]-2-methylprop-2-en-1-amine (PubChem CID 106438286) has the molecular formula C8H14ClF2NO and a molecular weight of 213.65 g/mol. Its IUPAC name is 3-chloro-N-[2-(2,2-difluoroethoxy)ethyl]-2-methylprop-2-en-1-amine.
| Compound Name | 3-chloro-N-[2-(2,2-difluoroethoxy)ethyl]-2-methylprop-2-en-1-amine |
|---|---|
| PubChem CID | 106438286 |
| Molecular Formula | C8H14ClF2NO |
| Molecular Weight | 213.65 g/mol |
| Exact Mass | 213.07 |
| IUPAC Name | 3-chloro-N-[2-(2,2-difluoroethoxy)ethyl]-2-methylprop-2-en-1-amine |
| SMILES | CC(=CCl)CNCCOCC(F)F |
| InChI | InChI=1S/C8H14ClF2NO/c1-7(4-9)5-12-2-3-13-6-8(10)11/h4,8,12H,2-3,5-6H2,1H3 |
| InChIKey | DDSZHFVXEZYJOT-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.65 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|