C13H12ClNO5 — CID 106438966
(E)-3-[3-[(Z)-3-chloro-2-methylprop-2-enoxy]-4-nitrophenyl]prop-2-enoic acid (PubChem CID 106438966) has the molecular formula C13H12ClNO5 and a molecular weight of 297.69 g/mol. Its IUPAC name is (E)-3-[3-[(Z)-3-chloro-2-methylprop-2-enoxy]-4-nitrophenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[3-[(Z)-3-chloro-2-methylprop-2-enoxy]-4-nitrophenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 106438966 |
| Molecular Formula | C13H12ClNO5 |
| Molecular Weight | 297.69 g/mol |
| Exact Mass | 297.04 |
| IUPAC Name | (E)-3-[3-[(Z)-3-chloro-2-methylprop-2-enoxy]-4-nitrophenyl]prop-2-enoic acid |
| SMILES | C/C(=C/Cl)COc1cc(/C=C/C(=O)O)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H12ClNO5/c1-9(7-14)8-20-12-6-10(3-5-13(16)17)2-4-11(12)15(18)19/h2-7H,8H2,1H3,(H,16,17)/b5-3+,9-7- |
| InChIKey | GZMNUKIKLQEWQW-PKWCJPJFSA-N |
| XLogP | 3.21 |
| TPSA | 89.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.69 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|