C12H9N3O6 — CID 76935874
3-[4-nitro-3-(1,2,4-oxadiazol-3-ylmethoxy)phenyl]prop-2-enoic acid (PubChem CID 76935874) has the molecular formula C12H9N3O6 and a molecular weight of 291.22 g/mol. Its IUPAC name is 3-[4-nitro-3-(1,2,4-oxadiazol-3-ylmethoxy)phenyl]prop-2-enoic acid.
| Compound Name | 3-[4-nitro-3-(1,2,4-oxadiazol-3-ylmethoxy)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 76935874 |
| Molecular Formula | C12H9N3O6 |
| Molecular Weight | 291.22 g/mol |
| Exact Mass | 291.05 |
| IUPAC Name | 3-[4-nitro-3-(1,2,4-oxadiazol-3-ylmethoxy)phenyl]prop-2-enoic acid |
| SMILES | O=C(O)C=Cc1ccc([N+](=O)[O-])c(OCc2ncon2)c1 |
| InChI | InChI=1S/C12H9N3O6/c16-12(17)4-2-8-1-3-9(15(18)19)10(5-8)20-6-11-13-7-21-14-11/h1-5,7H,6H2,(H,16,17) |
| InChIKey | XKNAZXSOJXCDLK-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 128.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.22 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|