C11H20ClNO2 — CID 106439882
2-[1-(3-chloro-2-methylprop-2-enyl)piperidin-4-yl]oxyethanol (PubChem CID 106439882) has the molecular formula C11H20ClNO2 and a molecular weight of 233.74 g/mol. Its IUPAC name is 2-[1-(3-chloro-2-methylprop-2-enyl)piperidin-4-yl]oxyethanol.
| Compound Name | 2-[1-(3-chloro-2-methylprop-2-enyl)piperidin-4-yl]oxyethanol |
|---|---|
| PubChem CID | 106439882 |
| Molecular Formula | C11H20ClNO2 |
| Molecular Weight | 233.74 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | 2-[1-(3-chloro-2-methylprop-2-enyl)piperidin-4-yl]oxyethanol |
| SMILES | CC(=CCl)CN1CCC(OCCO)CC1 |
| InChI | InChI=1S/C11H20ClNO2/c1-10(8-12)9-13-4-2-11(3-5-13)15-7-6-14/h8,11,14H,2-7,9H2,1H3 |
| InChIKey | WLUSTZVUZQDQAK-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.74 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |