C11H16ClN3O4S — CID 106444297
N-(2-chlorocyclopentyl)-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonamide (PubChem CID 106444297) has the molecular formula C11H16ClN3O4S and a molecular weight of 321.79 g/mol. Its IUPAC name is N-(2-chlorocyclopentyl)-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonamide.
| Compound Name | N-(2-chlorocyclopentyl)-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonamide |
|---|---|
| PubChem CID | 106444297 |
| Molecular Formula | C11H16ClN3O4S |
| Molecular Weight | 321.79 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | N-(2-chlorocyclopentyl)-1,3-dimethyl-2,4-dioxopyrimidine-5-sulfonamide |
| SMILES | Cn1cc(S(=O)(=O)NC2CCCC2Cl)c(=O)n(C)c1=O |
| InChI | InChI=1S/C11H16ClN3O4S/c1-14-6-9(10(16)15(2)11(14)17)20(18,19)13-8-5-3-4-7(8)12/h6-8,13H,3-5H2,1-2H3 |
| InChIKey | JSWQURCASPSBAQ-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 90.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.79 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|