C12H19IN4S — CID 106445744
5-iodo-2-(4-methylthiomorpholin-3-yl)-6-propylpyrimidin-4-amine (PubChem CID 106445744) has the molecular formula C12H19IN4S and a molecular weight of 378.28 g/mol. Its IUPAC name is 5-iodo-2-(4-methylthiomorpholin-3-yl)-6-propylpyrimidin-4-amine.
| Compound Name | 5-iodo-2-(4-methylthiomorpholin-3-yl)-6-propylpyrimidin-4-amine |
|---|---|
| PubChem CID | 106445744 |
| Molecular Formula | C12H19IN4S |
| Molecular Weight | 378.28 g/mol |
| Exact Mass | 378.04 |
| IUPAC Name | 5-iodo-2-(4-methylthiomorpholin-3-yl)-6-propylpyrimidin-4-amine |
| SMILES | CCCc1nc(C2CSCCN2C)nc(N)c1I |
| InChI | InChI=1S/C12H19IN4S/c1-3-4-8-10(13)11(14)16-12(15-8)9-7-18-6-5-17(9)2/h9H,3-7H2,1-2H3,(H2,14,15,16) |
| InChIKey | BRKMWOOQJFAYLP-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 55.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.28 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|