About 3-(5-iodo-1,2,4-thiadiazol-3-yl)-4-methylthiomorpholine
3-(5-iodo-1,2,4-thiadiazol-3-yl)-4-methylthiomorpholine (PubChem CID 106446173) has the molecular formula C7H10IN3S2
and a molecular weight of 327.22 g/mol. Its IUPAC name is 3-(5-iodo-1,2,4-thiadiazol-3-yl)-4-methylthiomorpholine.
Molecular Properties
| Compound Name | 3-(5-iodo-1,2,4-thiadiazol-3-yl)-4-methylthiomorpholine |
| PubChem CID | 106446173 |
| Molecular Formula | C7H10IN3S2 |
| Molecular Weight | 327.22 g/mol |
| Exact Mass | 326.94 |
| IUPAC Name | 3-(5-iodo-1,2,4-thiadiazol-3-yl)-4-methylthiomorpholine |
| SMILES | CN1CCSCC1c1nsc(I)n1 |
| InChI | InChI=1S/C7H10IN3S2/c1-11-2-3-12-4-5(11)6-9-7(8)13-10-6/h5H,2-4H2,1H3 |
| InChIKey | XDSLRKXLYJKBHN-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.22 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-(5-iodo-1,2,4-thiadiazol-3-yl)-4-methylthiomorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-iodo-1,2,4-thiadiazol-3-yl)-4-methylthiomorpholine?
The IUPAC name of 3-(5-iodo-1,2,4-thiadiazol-3-yl)-4-methylthiomorpholine (CID 106446173) is 3-(5-iodo-1,2,4-thiadiazol-3-yl)-4-methylthiomorpholine.
What is the SMILES notation for 3-(5-iodo-1,2,4-thiadiazol-3-yl)-4-methylthiomorpholine?
The canonical SMILES for 3-(5-iodo-1,2,4-thiadiazol-3-yl)-4-methylthiomorpholine is CN1CCSCC1c1nsc(I)n1.
What is the InChIKey of 3-(5-iodo-1,2,4-thiadiazol-3-yl)-4-methylthiomorpholine?
The InChIKey is XDSLRKXLYJKBHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10IN3S2/c1-11-2-3-12-4-5(11)6-9-7(8)13-10-6/h5H,2-4H2,1H3.
What are the key properties of 3-(5-iodo-1,2,4-thiadiazol-3-yl)-4-methylthiomorpholine?
3-(5-iodo-1,2,4-thiadiazol-3-yl)-4-methylthiomorpholine has a molecular weight of 327.22 g/mol, XLogP of 1.86, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-iodo-1,2,4-thiadiazol-3-yl)-4-methylthiomorpholine is sourced from PubChem (CID 106446173), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).