C27H44O2 — CID 10644705
(1S,2R,4R,6S,11S,12S,15R,16R)-2,16-dimethyl-15-[(2R)-6-methylheptan-2-yl]-5-oxapentacyclo[9.7.0.02,8.04,6.012,16]octadecan-9-one (PubChem CID 10644705) has the molecular formula C27H44O2 and a molecular weight of 400.65 g/mol. Its IUPAC name is (1S,2R,4R,6S,11S,12S,15R,16R)-2,16-dimethyl-15-[(2R)-6-methylheptan-2-yl]-5-oxapentacyclo[9.7.0.02,8.04,6.012,16]octadecan-9-one.
| Compound Name | (1S,2R,4R,6S,11S,12S,15R,16R)-2,16-dimethyl-15-[(2R)-6-methylheptan-2-yl]-5-oxapentacyclo[9.7.0.02,8.04,6.012,16]octadecan-9-one |
|---|---|
| PubChem CID | 10644705 |
| Molecular Formula | C27H44O2 |
| Molecular Weight | 400.65 g/mol |
| Exact Mass | 400.33 |
| IUPAC Name | (1S,2R,4R,6S,11S,12S,15R,16R)-2,16-dimethyl-15-[(2R)-6-methylheptan-2-yl]-5-oxapentacyclo[9.7.0.02,8.04,6.012,16]octadecan-9-one |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC(=O)C4C[C@@H]5O[C@@H]5C[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C27H44O2/c1-16(2)7-6-8-17(3)19-9-10-20-18-13-23(28)22-14-24-25(29-24)15-27(22,5)21(18)11-12-26(19,20)4/h16-22,24-25H,6-15H2,1-5H3/t17-,18+,19-,20+,21+,22?,24+,25-,26-,27-/m1/s1 |
| InChIKey | DEGMOIUJNNXOFD-GQUCQUSCSA-N |
| XLogP | 6.66 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.65 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|