C11H21NO4 — CID 106454746
4-[methyl(2-propoxyethyl)amino]oxolane-3-carboxylic acid (PubChem CID 106454746) has the molecular formula C11H21NO4 and a molecular weight of 231.29 g/mol. Its IUPAC name is 4-[methyl(2-propoxyethyl)amino]oxolane-3-carboxylic acid.
| Compound Name | 4-[methyl(2-propoxyethyl)amino]oxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 106454746 |
| Molecular Formula | C11H21NO4 |
| Molecular Weight | 231.29 g/mol |
| Exact Mass | 231.15 |
| IUPAC Name | 4-[methyl(2-propoxyethyl)amino]oxolane-3-carboxylic acid |
| SMILES | CCCOCCN(C)C1COCC1C(=O)O |
| InChI | InChI=1S/C11H21NO4/c1-3-5-15-6-4-12(2)10-8-16-7-9(10)11(13)14/h9-10H,3-8H2,1-2H3,(H,13,14) |
| InChIKey | XALHNWZKWNLSCN-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.29 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|