C12H23NO6 — CID 106991480
4-[[2-hydroxy-3-(2-methoxyethoxy)propyl]-methylamino]oxolane-3-carboxylic acid (PubChem CID 106991480) has the molecular formula C12H23NO6 and a molecular weight of 277.32 g/mol. Its IUPAC name is 4-[[2-hydroxy-3-(2-methoxyethoxy)propyl]-methylamino]oxolane-3-carboxylic acid.
| Compound Name | 4-[[2-hydroxy-3-(2-methoxyethoxy)propyl]-methylamino]oxolane-3-carboxylic acid |
|---|---|
| PubChem CID | 106991480 |
| Molecular Formula | C12H23NO6 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | 4-[[2-hydroxy-3-(2-methoxyethoxy)propyl]-methylamino]oxolane-3-carboxylic acid |
| SMILES | COCCOCC(O)CN(C)C1COCC1C(=O)O |
| InChI | InChI=1S/C12H23NO6/c1-13(5-9(14)6-18-4-3-17-2)11-8-19-7-10(11)12(15)16/h9-11,14H,3-8H2,1-2H3,(H,15,16) |
| InChIKey | DATIQKVGQLAKJC-UHFFFAOYSA-N |
| XLogP | -0.96 |
| TPSA | 88.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|