C13H21N3O2 — CID 106456454
3-[2-(2-methylpropoxy)ethyl]-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-4-one (PubChem CID 106456454) has the molecular formula C13H21N3O2 and a molecular weight of 251.33 g/mol. Its IUPAC name is 3-[2-(2-methylpropoxy)ethyl]-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-4-one.
| Compound Name | 3-[2-(2-methylpropoxy)ethyl]-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 106456454 |
| Molecular Formula | C13H21N3O2 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.16 |
| IUPAC Name | 3-[2-(2-methylpropoxy)ethyl]-5,6,7,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
| SMILES | CC(C)COCCn1cnc2c(c1=O)CCNC2 |
| InChI | InChI=1S/C13H21N3O2/c1-10(2)8-18-6-5-16-9-15-12-7-14-4-3-11(12)13(16)17/h9-10,14H,3-8H2,1-2H3 |
| InChIKey | YAUVULPDIACBBB-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|