C13H29NO — CID 106456556
N,4-dimethyl-2-[2-(2-methylpropoxy)ethyl]pentan-1-amine (PubChem CID 106456556) has the molecular formula C13H29NO and a molecular weight of 215.38 g/mol. Its IUPAC name is N,4-dimethyl-2-[2-(2-methylpropoxy)ethyl]pentan-1-amine.
| Compound Name | N,4-dimethyl-2-[2-(2-methylpropoxy)ethyl]pentan-1-amine |
|---|---|
| PubChem CID | 106456556 |
| Molecular Formula | C13H29NO |
| Molecular Weight | 215.38 g/mol |
| Exact Mass | 215.22 |
| IUPAC Name | N,4-dimethyl-2-[2-(2-methylpropoxy)ethyl]pentan-1-amine |
| SMILES | CNCC(CCOCC(C)C)CC(C)C |
| InChI | InChI=1S/C13H29NO/c1-11(2)8-13(9-14-5)6-7-15-10-12(3)4/h11-14H,6-10H2,1-5H3 |
| InChIKey | VBDMOMBPXQKBCM-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.38 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|