C14H31NO — CID 62529508
N,4-dimethyl-2-[2-(3-methylbutoxy)ethyl]pentan-1-amine (PubChem CID 62529508) has the molecular formula C14H31NO and a molecular weight of 229.41 g/mol. Its IUPAC name is N,4-dimethyl-2-[2-(3-methylbutoxy)ethyl]pentan-1-amine.
| Compound Name | N,4-dimethyl-2-[2-(3-methylbutoxy)ethyl]pentan-1-amine |
|---|---|
| PubChem CID | 62529508 |
| Molecular Formula | C14H31NO |
| Molecular Weight | 229.41 g/mol |
| Exact Mass | 229.24 |
| IUPAC Name | N,4-dimethyl-2-[2-(3-methylbutoxy)ethyl]pentan-1-amine |
| SMILES | CNCC(CCOCCC(C)C)CC(C)C |
| InChI | InChI=1S/C14H31NO/c1-12(2)6-8-16-9-7-14(11-15-5)10-13(3)4/h12-15H,6-11H2,1-5H3 |
| InChIKey | SYELFJGDMUWEDW-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.41 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|