C19H22Cl2N6O — CID 10645840
[(2R)-1-[6-(3,4-dichloroanilino)-9-propan-2-ylpurin-2-yl]pyrrolidin-2-yl]methanol (PubChem CID 10645840) has the molecular formula C19H22Cl2N6O and a molecular weight of 421.33 g/mol. Its IUPAC name is [(2R)-1-[6-(3,4-dichloroanilino)-9-propan-2-ylpurin-2-yl]pyrrolidin-2-yl]methanol.
| Compound Name | [(2R)-1-[6-(3,4-dichloroanilino)-9-propan-2-ylpurin-2-yl]pyrrolidin-2-yl]methanol |
|---|---|
| PubChem CID | 10645840 |
| Molecular Formula | C19H22Cl2N6O |
| Molecular Weight | 421.33 g/mol |
| Exact Mass | 420.12 |
| IUPAC Name | [(2R)-1-[6-(3,4-dichloroanilino)-9-propan-2-ylpurin-2-yl]pyrrolidin-2-yl]methanol |
| SMILES | CC(C)n1cnc2c(Nc3ccc(Cl)c(Cl)c3)nc(N3CCC[C@@H]3CO)nc21 |
| InChI | InChI=1S/C19H22Cl2N6O/c1-11(2)27-10-22-16-17(23-12-5-6-14(20)15(21)8-12)24-19(25-18(16)27)26-7-3-4-13(26)9-28/h5-6,8,10-11,13,28H,3-4,7,9H2,1-2H3,(H,23,24,25)/t13-/m1/s1 |
| InChIKey | ZPTAVVHUPQTZNT-CYBMUJFWSA-N |
| XLogP | 4.42 |
| TPSA | 79.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.33 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |