C15H18N2O2 — CID 106460351
10-cyclopropyl-4,9-dimethyl-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-11-one (PubChem CID 106460351) has the molecular formula C15H18N2O2 and a molecular weight of 258.32 g/mol. Its IUPAC name is 10-cyclopropyl-4,9-dimethyl-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-11-one.
| Compound Name | 10-cyclopropyl-4,9-dimethyl-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-11-one |
|---|---|
| PubChem CID | 106460351 |
| Molecular Formula | C15H18N2O2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | 10-cyclopropyl-4,9-dimethyl-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2(7),3,5-trien-11-one |
| SMILES | Cc1ccc2c(c1)C1CC(C)(O2)N(C2CC2)C(=O)N1 |
| InChI | InChI=1S/C15H18N2O2/c1-9-3-6-13-11(7-9)12-8-15(2,19-13)17(10-4-5-10)14(18)16-12/h3,6-7,10,12H,4-5,8H2,1-2H3,(H,16,18) |
| InChIKey | KXJAWRFZSMBASF-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |