C16H22N2OS — CID 106460814
10-butan-2-yl-9,13-dimethyl-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2,4,6-triene-11-thione (PubChem CID 106460814) has the molecular formula C16H22N2OS and a molecular weight of 290.43 g/mol. Its IUPAC name is 10-butan-2-yl-9,13-dimethyl-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2,4,6-triene-11-thione.
| Compound Name | 10-butan-2-yl-9,13-dimethyl-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2,4,6-triene-11-thione |
|---|---|
| PubChem CID | 106460814 |
| Molecular Formula | C16H22N2OS |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 10-butan-2-yl-9,13-dimethyl-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2,4,6-triene-11-thione |
| SMILES | CCC(C)N1C(=S)NC2c3ccccc3OC1(C)C2C |
| InChI | InChI=1S/C16H22N2OS/c1-5-10(2)18-15(20)17-14-11(3)16(18,4)19-13-9-7-6-8-12(13)14/h6-11,14H,5H2,1-4H3,(H,17,20) |
| InChIKey | QEKUWNJOGIAKKU-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|