C16H20N2OS — CID 106460822
9,13-dimethyl-10-(2-methylprop-2-enyl)-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2,4,6-triene-11-thione (PubChem CID 106460822) has the molecular formula C16H20N2OS and a molecular weight of 288.42 g/mol. Its IUPAC name is 9,13-dimethyl-10-(2-methylprop-2-enyl)-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2,4,6-triene-11-thione.
| Compound Name | 9,13-dimethyl-10-(2-methylprop-2-enyl)-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2,4,6-triene-11-thione |
|---|---|
| PubChem CID | 106460822 |
| Molecular Formula | C16H20N2OS |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | 9,13-dimethyl-10-(2-methylprop-2-enyl)-8-oxa-10,12-diazatricyclo[7.3.1.02,7]trideca-2,4,6-triene-11-thione |
| SMILES | C=C(C)CN1C(=S)NC2c3ccccc3OC1(C)C2C |
| InChI | InChI=1S/C16H20N2OS/c1-10(2)9-18-15(20)17-14-11(3)16(18,4)19-13-8-6-5-7-12(13)14/h5-8,11,14H,1,9H2,2-4H3,(H,17,20) |
| InChIKey | CSDOLUFGQHBWHO-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|