C10H12BrN3O2 — CID 106461197
(5-bromo-3-methyltriazol-4-yl)-(5-ethylfuran-2-yl)methanol (PubChem CID 106461197) has the molecular formula C10H12BrN3O2 and a molecular weight of 286.13 g/mol. Its IUPAC name is (5-bromo-3-methyltriazol-4-yl)-(5-ethylfuran-2-yl)methanol.
| Compound Name | (5-bromo-3-methyltriazol-4-yl)-(5-ethylfuran-2-yl)methanol |
|---|---|
| PubChem CID | 106461197 |
| Molecular Formula | C10H12BrN3O2 |
| Molecular Weight | 286.13 g/mol |
| Exact Mass | 285.01 |
| IUPAC Name | (5-bromo-3-methyltriazol-4-yl)-(5-ethylfuran-2-yl)methanol |
| SMILES | CCc1ccc(C(O)c2c(Br)nnn2C)o1 |
| InChI | InChI=1S/C10H12BrN3O2/c1-3-6-4-5-7(16-6)9(15)8-10(11)12-13-14(8)2/h4-5,9,15H,3H2,1-2H3 |
| InChIKey | RZCHZXMMPMMBAR-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.13 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |