C13H16BrN3O4 — CID 106461168
(5-bromo-3-methyltriazol-4-yl)-(2,4,5-trimethoxyphenyl)methanol (PubChem CID 106461168) has the molecular formula C13H16BrN3O4 and a molecular weight of 358.19 g/mol. Its IUPAC name is (5-bromo-3-methyltriazol-4-yl)-(2,4,5-trimethoxyphenyl)methanol.
| Compound Name | (5-bromo-3-methyltriazol-4-yl)-(2,4,5-trimethoxyphenyl)methanol |
|---|---|
| PubChem CID | 106461168 |
| Molecular Formula | C13H16BrN3O4 |
| Molecular Weight | 358.19 g/mol |
| Exact Mass | 357.03 |
| IUPAC Name | (5-bromo-3-methyltriazol-4-yl)-(2,4,5-trimethoxyphenyl)methanol |
| SMILES | COc1cc(OC)c(C(O)c2c(Br)nnn2C)cc1OC |
| InChI | InChI=1S/C13H16BrN3O4/c1-17-11(13(14)15-16-17)12(18)7-5-9(20-3)10(21-4)6-8(7)19-2/h5-6,12,18H,1-4H3 |
| InChIKey | LXUGPAQWCLERHH-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 78.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.19 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |