C12H14BrN3O3 — CID 106461135
(5-bromo-3-methyltriazol-4-yl)-(2,4-dimethoxyphenyl)methanol (PubChem CID 106461135) has the molecular formula C12H14BrN3O3 and a molecular weight of 328.17 g/mol. Its IUPAC name is (5-bromo-3-methyltriazol-4-yl)-(2,4-dimethoxyphenyl)methanol.
| Compound Name | (5-bromo-3-methyltriazol-4-yl)-(2,4-dimethoxyphenyl)methanol |
|---|---|
| PubChem CID | 106461135 |
| Molecular Formula | C12H14BrN3O3 |
| Molecular Weight | 328.17 g/mol |
| Exact Mass | 327.02 |
| IUPAC Name | (5-bromo-3-methyltriazol-4-yl)-(2,4-dimethoxyphenyl)methanol |
| SMILES | COc1ccc(C(O)c2c(Br)nnn2C)c(OC)c1 |
| InChI | InChI=1S/C12H14BrN3O3/c1-16-10(12(13)14-15-16)11(17)8-5-4-7(18-2)6-9(8)19-3/h4-6,11,17H,1-3H3 |
| InChIKey | GPVKESZCEZBKSM-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.17 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |