C14H17NO3 — CID 97293057
(S)-(2,4-dimethoxyphenyl)-(1-methylpyrrol-2-yl)methanol (PubChem CID 97293057) has the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. Its IUPAC name is (S)-(2,4-dimethoxyphenyl)-(1-methylpyrrol-2-yl)methanol.
| Compound Name | (S)-(2,4-dimethoxyphenyl)-(1-methylpyrrol-2-yl)methanol |
|---|---|
| PubChem CID | 97293057 |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | (S)-(2,4-dimethoxyphenyl)-(1-methylpyrrol-2-yl)methanol |
| SMILES | COc1ccc([C@H](O)c2cccn2C)c(OC)c1 |
| InChI | InChI=1S/C14H17NO3/c1-15-8-4-5-12(15)14(16)11-7-6-10(17-2)9-13(11)18-3/h4-9,14,16H,1-3H3/t14-/m0/s1 |
| InChIKey | QJUHDKUDCRGIDF-AWEZNQCLSA-N |
| XLogP | 2.12 |
| TPSA | 43.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |