C15H17NO3 — CID 63553982
(2,4-dimethoxyphenyl)-(6-methyl-2-pyridinyl)methanol (PubChem CID 63553982) has the molecular formula C15H17NO3 and a molecular weight of 259.31 g/mol. Its IUPAC name is (2,4-dimethoxyphenyl)-(6-methyl-2-pyridinyl)methanol.
| Compound Name | (2,4-dimethoxyphenyl)-(6-methyl-2-pyridinyl)methanol |
|---|---|
| PubChem CID | 63553982 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | (2,4-dimethoxyphenyl)-(6-methyl-2-pyridinyl)methanol |
| SMILES | COc1ccc(C(O)c2cccc(C)n2)c(OC)c1 |
| InChI | InChI=1S/C15H17NO3/c1-10-5-4-6-13(16-10)15(17)12-8-7-11(18-2)9-14(12)19-3/h4-9,15,17H,1-3H3 |
| InChIKey | MGOFNGVNVUJGLH-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |