C12H12BrN3O3 — CID 106461753
(5-bromo-3-methyltriazol-4-yl)-(3,5-dimethoxyphenyl)methanone (PubChem CID 106461753) has the molecular formula C12H12BrN3O3 and a molecular weight of 326.15 g/mol. Its IUPAC name is (5-bromo-3-methyltriazol-4-yl)-(3,5-dimethoxyphenyl)methanone.
| Compound Name | (5-bromo-3-methyltriazol-4-yl)-(3,5-dimethoxyphenyl)methanone |
|---|---|
| PubChem CID | 106461753 |
| Molecular Formula | C12H12BrN3O3 |
| Molecular Weight | 326.15 g/mol |
| Exact Mass | 325.01 |
| IUPAC Name | (5-bromo-3-methyltriazol-4-yl)-(3,5-dimethoxyphenyl)methanone |
| SMILES | COc1cc(OC)cc(C(=O)c2c(Br)nnn2C)c1 |
| InChI | InChI=1S/C12H12BrN3O3/c1-16-10(12(13)14-15-16)11(17)7-4-8(18-2)6-9(5-7)19-3/h4-6H,1-3H3 |
| InChIKey | LHAFZOZOGKNLEM-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 66.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.15 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |