C13H17BrN4O — CID 106463054
1-(5-bromo-3-methyltriazol-4-yl)-2-methoxy-N-methyl-2-phenylethanamine (PubChem CID 106463054) has the molecular formula C13H17BrN4O and a molecular weight of 325.21 g/mol. Its IUPAC name is 1-(5-bromo-3-methyltriazol-4-yl)-2-methoxy-N-methyl-2-phenylethanamine.
| Compound Name | 1-(5-bromo-3-methyltriazol-4-yl)-2-methoxy-N-methyl-2-phenylethanamine |
|---|---|
| PubChem CID | 106463054 |
| Molecular Formula | C13H17BrN4O |
| Molecular Weight | 325.21 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | 1-(5-bromo-3-methyltriazol-4-yl)-2-methoxy-N-methyl-2-phenylethanamine |
| SMILES | CNC(c1c(Br)nnn1C)C(OC)c1ccccc1 |
| InChI | InChI=1S/C13H17BrN4O/c1-15-10(11-13(14)16-17-18(11)2)12(19-3)9-7-5-4-6-8-9/h4-8,10,12,15H,1-3H3 |
| InChIKey | PQOSWDKRPNWGJP-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.21 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |