C10H20BrN5O — CID 106466227
[1-(5-bromo-3-methyltriazol-4-yl)-2-methoxy-3,3-dimethylbutyl]hydrazine (PubChem CID 106466227) has the molecular formula C10H20BrN5O and a molecular weight of 306.21 g/mol. Its IUPAC name is [1-(5-bromo-3-methyltriazol-4-yl)-2-methoxy-3,3-dimethylbutyl]hydrazine.
| Compound Name | [1-(5-bromo-3-methyltriazol-4-yl)-2-methoxy-3,3-dimethylbutyl]hydrazine |
|---|---|
| PubChem CID | 106466227 |
| Molecular Formula | C10H20BrN5O |
| Molecular Weight | 306.21 g/mol |
| Exact Mass | 305.09 |
| IUPAC Name | [1-(5-bromo-3-methyltriazol-4-yl)-2-methoxy-3,3-dimethylbutyl]hydrazine |
| SMILES | COC(C(NN)c1c(Br)nnn1C)C(C)(C)C |
| InChI | InChI=1S/C10H20BrN5O/c1-10(2,3)8(17-5)6(13-12)7-9(11)14-15-16(7)4/h6,8,13H,12H2,1-5H3 |
| InChIKey | LVQQIAKFQJWTIL-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.21 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|