C10H7BrF5N5 — CID 106466621
[(5-bromo-3-methyltriazol-4-yl)-(2,3,4,5,6-pentafluorophenyl)methyl]hydrazine (PubChem CID 106466621) has the molecular formula C10H7BrF5N5 and a molecular weight of 372.10 g/mol. Its IUPAC name is [(5-bromo-3-methyltriazol-4-yl)-(2,3,4,5,6-pentafluorophenyl)methyl]hydrazine.
| Compound Name | [(5-bromo-3-methyltriazol-4-yl)-(2,3,4,5,6-pentafluorophenyl)methyl]hydrazine |
|---|---|
| PubChem CID | 106466621 |
| Molecular Formula | C10H7BrF5N5 |
| Molecular Weight | 372.10 g/mol |
| Exact Mass | 370.98 |
| IUPAC Name | [(5-bromo-3-methyltriazol-4-yl)-(2,3,4,5,6-pentafluorophenyl)methyl]hydrazine |
| SMILES | Cn1nnc(Br)c1C(NN)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C10H7BrF5N5/c1-21-9(10(11)19-20-21)8(18-17)2-3(12)5(14)7(16)6(15)4(2)13/h8,18H,17H2,1H3 |
| InChIKey | ODANOKIGRPWLJY-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 68.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.10 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|