C10H6BrF5N4 — CID 106464948
(5-bromo-3-methyltriazol-4-yl)-(2,3,4,5,6-pentafluorophenyl)methanamine (PubChem CID 106464948) has the molecular formula C10H6BrF5N4 and a molecular weight of 357.08 g/mol. Its IUPAC name is (5-bromo-3-methyltriazol-4-yl)-(2,3,4,5,6-pentafluorophenyl)methanamine.
| Compound Name | (5-bromo-3-methyltriazol-4-yl)-(2,3,4,5,6-pentafluorophenyl)methanamine |
|---|---|
| PubChem CID | 106464948 |
| Molecular Formula | C10H6BrF5N4 |
| Molecular Weight | 357.08 g/mol |
| Exact Mass | 355.97 |
| IUPAC Name | (5-bromo-3-methyltriazol-4-yl)-(2,3,4,5,6-pentafluorophenyl)methanamine |
| SMILES | Cn1nnc(Br)c1C(N)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C10H6BrF5N4/c1-20-9(10(11)18-19-20)8(17)2-3(12)5(14)7(16)6(15)4(2)13/h8H,17H2,1H3 |
| InChIKey | SMLUDCCXAHTUIS-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.08 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|