C9H10Br2N4S — CID 106464575
(5-bromo-4-methylthiophen-2-yl)-(5-bromo-3-methyltriazol-4-yl)methanamine (PubChem CID 106464575) has the molecular formula C9H10Br2N4S and a molecular weight of 366.08 g/mol. Its IUPAC name is (5-bromo-4-methylthiophen-2-yl)-(5-bromo-3-methyltriazol-4-yl)methanamine.
| Compound Name | (5-bromo-4-methylthiophen-2-yl)-(5-bromo-3-methyltriazol-4-yl)methanamine |
|---|---|
| PubChem CID | 106464575 |
| Molecular Formula | C9H10Br2N4S |
| Molecular Weight | 366.08 g/mol |
| Exact Mass | 363.90 |
| IUPAC Name | (5-bromo-4-methylthiophen-2-yl)-(5-bromo-3-methyltriazol-4-yl)methanamine |
| SMILES | Cc1cc(C(N)c2c(Br)nnn2C)sc1Br |
| InChI | InChI=1S/C9H10Br2N4S/c1-4-3-5(16-9(4)11)6(12)7-8(10)13-14-15(7)2/h3,6H,12H2,1-2H3 |
| InChIKey | CLXOXFUVSGZUQZ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.08 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |