C9H11BrN4OS — CID 106464848
(5-bromo-3-methyltriazol-4-yl)-(4-methoxythiophen-2-yl)methanamine (PubChem CID 106464848) has the molecular formula C9H11BrN4OS and a molecular weight of 303.19 g/mol. Its IUPAC name is (5-bromo-3-methyltriazol-4-yl)-(4-methoxythiophen-2-yl)methanamine.
| Compound Name | (5-bromo-3-methyltriazol-4-yl)-(4-methoxythiophen-2-yl)methanamine |
|---|---|
| PubChem CID | 106464848 |
| Molecular Formula | C9H11BrN4OS |
| Molecular Weight | 303.19 g/mol |
| Exact Mass | 301.98 |
| IUPAC Name | (5-bromo-3-methyltriazol-4-yl)-(4-methoxythiophen-2-yl)methanamine |
| SMILES | COc1csc(C(N)c2c(Br)nnn2C)c1 |
| InChI | InChI=1S/C9H11BrN4OS/c1-14-8(9(10)12-13-14)7(11)6-3-5(15-2)4-16-6/h3-4,7H,11H2,1-2H3 |
| InChIKey | BYCDOCUHVBZNIV-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.19 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |