C8H8BrClN4S — CID 106464957
(5-bromo-3-methyltriazol-4-yl)-(3-chlorothiophen-2-yl)methanamine (PubChem CID 106464957) has the molecular formula C8H8BrClN4S and a molecular weight of 307.60 g/mol. Its IUPAC name is (5-bromo-3-methyltriazol-4-yl)-(3-chlorothiophen-2-yl)methanamine.
| Compound Name | (5-bromo-3-methyltriazol-4-yl)-(3-chlorothiophen-2-yl)methanamine |
|---|---|
| PubChem CID | 106464957 |
| Molecular Formula | C8H8BrClN4S |
| Molecular Weight | 307.60 g/mol |
| Exact Mass | 305.93 |
| IUPAC Name | (5-bromo-3-methyltriazol-4-yl)-(3-chlorothiophen-2-yl)methanamine |
| SMILES | Cn1nnc(Br)c1C(N)c1sccc1Cl |
| InChI | InChI=1S/C8H8BrClN4S/c1-14-6(8(9)12-13-14)5(11)7-4(10)2-3-15-7/h2-3,5H,11H2,1H3 |
| InChIKey | YRZJOKFQXGTLGA-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.60 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |