C9H9BrFN5 — CID 106464908
(5-bromo-3-methyltriazol-4-yl)-(5-fluoro-3-pyridinyl)methanamine (PubChem CID 106464908) has the molecular formula C9H9BrFN5 and a molecular weight of 286.11 g/mol. Its IUPAC name is (5-bromo-3-methyltriazol-4-yl)-(5-fluoro-3-pyridinyl)methanamine.
| Compound Name | (5-bromo-3-methyltriazol-4-yl)-(5-fluoro-3-pyridinyl)methanamine |
|---|---|
| PubChem CID | 106464908 |
| Molecular Formula | C9H9BrFN5 |
| Molecular Weight | 286.11 g/mol |
| Exact Mass | 285.00 |
| IUPAC Name | (5-bromo-3-methyltriazol-4-yl)-(5-fluoro-3-pyridinyl)methanamine |
| SMILES | Cn1nnc(Br)c1C(N)c1cncc(F)c1 |
| InChI | InChI=1S/C9H9BrFN5/c1-16-8(9(10)14-15-16)7(12)5-2-6(11)4-13-3-5/h2-4,7H,12H2,1H3 |
| InChIKey | BUJPCHPUCPBOPI-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.11 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |