About [2-methoxy-3,3-dimethyl-1-(1-methylpyrazol-3-yl)butyl]hydrazine
[2-methoxy-3,3-dimethyl-1-(1-methylpyrazol-3-yl)butyl]hydrazine (PubChem CID 103140646) has the molecular formula C11H22N4O
and a molecular weight of 226.32 g/mol. Its IUPAC name is [2-methoxy-3,3-dimethyl-1-(1-methylpyrazol-3-yl)butyl]hydrazine.
Molecular Properties
| Compound Name | [2-methoxy-3,3-dimethyl-1-(1-methylpyrazol-3-yl)butyl]hydrazine |
| PubChem CID | 103140646 |
| Molecular Formula | C11H22N4O |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.18 |
| IUPAC Name | [2-methoxy-3,3-dimethyl-1-(1-methylpyrazol-3-yl)butyl]hydrazine |
| SMILES | COC(C(NN)c1ccn(C)n1)C(C)(C)C |
| InChI | InChI=1S/C11H22N4O/c1-11(2,3)10(16-5)9(13-12)8-6-7-15(4)14-8/h6-7,9-10,13H,12H2,1-5H3 |
| InChIKey | RSVUKTRRZFVBCR-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [2-methoxy-3,3-dimethyl-1-(1-methylpyrazol-3-yl)butyl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-methoxy-3,3-dimethyl-1-(1-methylpyrazol-3-yl)butyl]hydrazine?
The IUPAC name of [2-methoxy-3,3-dimethyl-1-(1-methylpyrazol-3-yl)butyl]hydrazine (CID 103140646) is [2-methoxy-3,3-dimethyl-1-(1-methylpyrazol-3-yl)butyl]hydrazine.
What is the SMILES notation for [2-methoxy-3,3-dimethyl-1-(1-methylpyrazol-3-yl)butyl]hydrazine?
The canonical SMILES for [2-methoxy-3,3-dimethyl-1-(1-methylpyrazol-3-yl)butyl]hydrazine is COC(C(NN)c1ccn(C)n1)C(C)(C)C.
What is the InChIKey of [2-methoxy-3,3-dimethyl-1-(1-methylpyrazol-3-yl)butyl]hydrazine?
The InChIKey is RSVUKTRRZFVBCR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N4O/c1-11(2,3)10(16-5)9(13-12)8-6-7-15(4)14-8/h6-7,9-10,13H,12H2,1-5H3.
What are the key properties of [2-methoxy-3,3-dimethyl-1-(1-methylpyrazol-3-yl)butyl]hydrazine?
[2-methoxy-3,3-dimethyl-1-(1-methylpyrazol-3-yl)butyl]hydrazine has a molecular weight of 226.32 g/mol, XLogP of 0.99, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-methoxy-3,3-dimethyl-1-(1-methylpyrazol-3-yl)butyl]hydrazine is sourced from PubChem (CID 103140646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).