C11H22N4O — CID 103140646
[2-methoxy-3,3-dimethyl-1-(1-methylpyrazol-3-yl)butyl]hydrazine (PubChem CID 103140646) has the molecular formula C11H22N4O and a molecular weight of 226.32 g/mol. Its IUPAC name is [2-methoxy-3,3-dimethyl-1-(1-methylpyrazol-3-yl)butyl]hydrazine.
| Compound Name | [2-methoxy-3,3-dimethyl-1-(1-methylpyrazol-3-yl)butyl]hydrazine |
|---|---|
| PubChem CID | 103140646 |
| Molecular Formula | C11H22N4O |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.18 |
| IUPAC Name | [2-methoxy-3,3-dimethyl-1-(1-methylpyrazol-3-yl)butyl]hydrazine |
| SMILES | COC(C(NN)c1ccn(C)n1)C(C)(C)C |
| InChI | InChI=1S/C11H22N4O/c1-11(2,3)10(16-5)9(13-12)8-6-7-15(4)14-8/h6-7,9-10,13H,12H2,1-5H3 |
| InChIKey | RSVUKTRRZFVBCR-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 65.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|