C10H19BrN4O — CID 106463854
2-(5-bromo-3-methyltriazol-4-yl)-4-(propan-2-ylamino)butan-2-ol (PubChem CID 106463854) has the molecular formula C10H19BrN4O and a molecular weight of 291.19 g/mol. Its IUPAC name is 2-(5-bromo-3-methyltriazol-4-yl)-4-(propan-2-ylamino)butan-2-ol.
| Compound Name | 2-(5-bromo-3-methyltriazol-4-yl)-4-(propan-2-ylamino)butan-2-ol |
|---|---|
| PubChem CID | 106463854 |
| Molecular Formula | C10H19BrN4O |
| Molecular Weight | 291.19 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | 2-(5-bromo-3-methyltriazol-4-yl)-4-(propan-2-ylamino)butan-2-ol |
| SMILES | CC(C)NCCC(C)(O)c1c(Br)nnn1C |
| InChI | InChI=1S/C10H19BrN4O/c1-7(2)12-6-5-10(3,16)8-9(11)13-14-15(8)4/h7,12,16H,5-6H2,1-4H3 |
| InChIKey | DNEZOEZSZHALJE-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 62.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.19 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |