C8H14BrF2N5O — CID 106466287
[1-(5-bromo-3-methyltriazol-4-yl)-3-(2,2-difluoroethoxy)propyl]hydrazine (PubChem CID 106466287) has the molecular formula C8H14BrF2N5O and a molecular weight of 314.13 g/mol. Its IUPAC name is [1-(5-bromo-3-methyltriazol-4-yl)-3-(2,2-difluoroethoxy)propyl]hydrazine.
| Compound Name | [1-(5-bromo-3-methyltriazol-4-yl)-3-(2,2-difluoroethoxy)propyl]hydrazine |
|---|---|
| PubChem CID | 106466287 |
| Molecular Formula | C8H14BrF2N5O |
| Molecular Weight | 314.13 g/mol |
| Exact Mass | 313.03 |
| IUPAC Name | [1-(5-bromo-3-methyltriazol-4-yl)-3-(2,2-difluoroethoxy)propyl]hydrazine |
| SMILES | Cn1nnc(Br)c1C(CCOCC(F)F)NN |
| InChI | InChI=1S/C8H14BrF2N5O/c1-16-7(8(9)14-15-16)5(13-12)2-3-17-4-6(10)11/h5-6,13H,2-4,12H2,1H3 |
| InChIKey | WYEUEFOXTHDLGH-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.13 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|