C15H16ClFO4 — CID 106469684
ethyl 3-[(2-chloro-4-fluorophenyl)methyl]-4-oxooxane-3-carboxylate (PubChem CID 106469684) has the molecular formula C15H16ClFO4 and a molecular weight of 314.74 g/mol. Its IUPAC name is ethyl 3-[(2-chloro-4-fluorophenyl)methyl]-4-oxooxane-3-carboxylate.
| Compound Name | ethyl 3-[(2-chloro-4-fluorophenyl)methyl]-4-oxooxane-3-carboxylate |
|---|---|
| PubChem CID | 106469684 |
| Molecular Formula | C15H16ClFO4 |
| Molecular Weight | 314.74 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | ethyl 3-[(2-chloro-4-fluorophenyl)methyl]-4-oxooxane-3-carboxylate |
| SMILES | CCOC(=O)C1(Cc2ccc(F)cc2Cl)COCCC1=O |
| InChI | InChI=1S/C15H16ClFO4/c1-2-21-14(19)15(9-20-6-5-13(15)18)8-10-3-4-11(17)7-12(10)16/h3-4,7H,2,5-6,8-9H2,1H3 |
| InChIKey | CNYTUUCHCOWRLL-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.74 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|