C11H18O6 — CID 106469748
ethyl 3-(2,3-dihydroxypropyl)-4-oxooxane-3-carboxylate (PubChem CID 106469748) has the molecular formula C11H18O6 and a molecular weight of 246.26 g/mol. Its IUPAC name is ethyl 3-(2,3-dihydroxypropyl)-4-oxooxane-3-carboxylate.
| Compound Name | ethyl 3-(2,3-dihydroxypropyl)-4-oxooxane-3-carboxylate |
|---|---|
| PubChem CID | 106469748 |
| Molecular Formula | C11H18O6 |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | ethyl 3-(2,3-dihydroxypropyl)-4-oxooxane-3-carboxylate |
| SMILES | CCOC(=O)C1(CC(O)CO)COCCC1=O |
| InChI | InChI=1S/C11H18O6/c1-2-17-10(15)11(5-8(13)6-12)7-16-4-3-9(11)14/h8,12-13H,2-7H2,1H3 |
| InChIKey | XMSQMHPXLDQQKU-UHFFFAOYSA-N |
| XLogP | -0.73 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.26 |
| LogP ≤ 5 | -0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|