C14H15BrO5 — CID 106470035
3-[(3-bromo-4-methoxyphenyl)methyl]-4-oxooxane-3-carboxylic acid (PubChem CID 106470035) has the molecular formula C14H15BrO5 and a molecular weight of 343.17 g/mol. Its IUPAC name is 3-[(3-bromo-4-methoxyphenyl)methyl]-4-oxooxane-3-carboxylic acid.
| Compound Name | 3-[(3-bromo-4-methoxyphenyl)methyl]-4-oxooxane-3-carboxylic acid |
|---|---|
| PubChem CID | 106470035 |
| Molecular Formula | C14H15BrO5 |
| Molecular Weight | 343.17 g/mol |
| Exact Mass | 342.01 |
| IUPAC Name | 3-[(3-bromo-4-methoxyphenyl)methyl]-4-oxooxane-3-carboxylic acid |
| SMILES | COc1ccc(CC2(C(=O)O)COCCC2=O)cc1Br |
| InChI | InChI=1S/C14H15BrO5/c1-19-11-3-2-9(6-10(11)15)7-14(13(17)18)8-20-5-4-12(14)16/h2-3,6H,4-5,7-8H2,1H3,(H,17,18) |
| InChIKey | HZXHUMVXEZGPSL-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.17 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|