About 3-pent-3-ynyloxan-4-ol
3-pent-3-ynyloxan-4-ol (PubChem CID 106471270) has the molecular formula C10H16O2
and a molecular weight of 168.24 g/mol. Its IUPAC name is 3-pent-3-ynyloxan-4-ol.
Molecular Properties
| Compound Name | 3-pent-3-ynyloxan-4-ol |
| PubChem CID | 106471270 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | 3-pent-3-ynyloxan-4-ol |
| SMILES | CC#CCCC1COCCC1O |
| InChI | InChI=1S/C10H16O2/c1-2-3-4-5-9-8-12-7-6-10(9)11/h9-11H,4-8H2,1H3 |
| InChIKey | WDYDJBYIVKTHKT-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-pent-3-ynyloxan-4-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-pent-3-ynyloxan-4-ol?
The IUPAC name of 3-pent-3-ynyloxan-4-ol (CID 106471270) is 3-pent-3-ynyloxan-4-ol.
What is the SMILES notation for 3-pent-3-ynyloxan-4-ol?
The canonical SMILES for 3-pent-3-ynyloxan-4-ol is CC#CCCC1COCCC1O.
What is the InChIKey of 3-pent-3-ynyloxan-4-ol?
The InChIKey is WDYDJBYIVKTHKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O2/c1-2-3-4-5-9-8-12-7-6-10(9)11/h9-11H,4-8H2,1H3.
What are the key properties of 3-pent-3-ynyloxan-4-ol?
3-pent-3-ynyloxan-4-ol has a molecular weight of 168.24 g/mol, XLogP of 1.19, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-pent-3-ynyloxan-4-ol is sourced from PubChem (CID 106471270), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).