C24H48O2Si3 — CID 10647315
2-[(3S,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylcyclohexen-1-yl]ethynyl-trimethylsilane (PubChem CID 10647315) has the molecular formula C24H48O2Si3 and a molecular weight of 452.90 g/mol. Its IUPAC name is 2-[(3S,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylcyclohexen-1-yl]ethynyl-trimethylsilane.
| Compound Name | 2-[(3S,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylcyclohexen-1-yl]ethynyl-trimethylsilane |
|---|---|
| PubChem CID | 10647315 |
| Molecular Formula | C24H48O2Si3 |
| Molecular Weight | 452.90 g/mol |
| Exact Mass | 452.30 |
| IUPAC Name | 2-[(3S,5R)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylcyclohexen-1-yl]ethynyl-trimethylsilane |
| SMILES | CC1=C(C#C[Si](C)(C)C)C[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C24H48O2Si3/c1-19-20(15-16-27(8,9)10)17-21(25-28(11,12)23(2,3)4)18-22(19)26-29(13,14)24(5,6)7/h21-22H,17-18H2,1-14H3/t21-,22+/m1/s1 |
| InChIKey | JTMFSALFYADLSW-YADHBBJMSA-N |
| XLogP | 7.76 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.90 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|