C24H27F2N5O2 — CID 10647424
(4R)-4-(3,4-difluorophenyl)-2-oxo-N-[3-(4-pyridin-2-ylpiperidin-1-yl)propyl]-3,4-dihydro-1H-pyrimidine-5-carboxamide (PubChem CID 10647424) has the molecular formula C24H27F2N5O2 and a molecular weight of 455.51 g/mol. Its IUPAC name is (4R)-4-(3,4-difluorophenyl)-2-oxo-N-[3-(4-pyridin-2-ylpiperidin-1-yl)propyl]-3,4-dihydro-1H-pyrimidine-5-carboxamide.
| Compound Name | (4R)-4-(3,4-difluorophenyl)-2-oxo-N-[3-(4-pyridin-2-ylpiperidin-1-yl)propyl]-3,4-dihydro-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 10647424 |
| Molecular Formula | C24H27F2N5O2 |
| Molecular Weight | 455.51 g/mol |
| Exact Mass | 455.21 |
| IUPAC Name | (4R)-4-(3,4-difluorophenyl)-2-oxo-N-[3-(4-pyridin-2-ylpiperidin-1-yl)propyl]-3,4-dihydro-1H-pyrimidine-5-carboxamide |
| SMILES | O=C1NC=C(C(=O)NCCCN2CCC(c3ccccn3)CC2)[C@@H](c2ccc(F)c(F)c2)N1 |
| InChI | InChI=1S/C24H27F2N5O2/c25-19-6-5-17(14-20(19)26)22-18(15-29-24(33)30-22)23(32)28-10-3-11-31-12-7-16(8-13-31)21-4-1-2-9-27-21/h1-2,4-6,9,14-16,22H,3,7-8,10-13H2,(H,28,32)(H2,29,30,33)/t22-/m1/s1 |
| InChIKey | ZMXFHYHEZZYYHG-JOCHJYFZSA-N |
| XLogP | 2.98 |
| TPSA | 86.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.51 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|