C14H19N3O2S — CID 106474293
N-propyl-3-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)oxan-4-amine (PubChem CID 106474293) has the molecular formula C14H19N3O2S and a molecular weight of 293.39 g/mol. Its IUPAC name is N-propyl-3-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)oxan-4-amine.
| Compound Name | N-propyl-3-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)oxan-4-amine |
|---|---|
| PubChem CID | 106474293 |
| Molecular Formula | C14H19N3O2S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | N-propyl-3-(3-thiophen-2-yl-1,2,4-oxadiazol-5-yl)oxan-4-amine |
| SMILES | CCCNC1CCOCC1c1nc(-c2cccs2)no1 |
| InChI | InChI=1S/C14H19N3O2S/c1-2-6-15-11-5-7-18-9-10(11)14-16-13(17-19-14)12-4-3-8-20-12/h3-4,8,10-11,15H,2,5-7,9H2,1H3 |
| InChIKey | FUYUGSBGWXZYHI-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |