C14H17N3O2 — CID 106474300
N-methyl-3-(3-phenyl-1,2,4-oxadiazol-5-yl)oxan-4-amine (PubChem CID 106474300) has the molecular formula C14H17N3O2 and a molecular weight of 259.31 g/mol. Its IUPAC name is N-methyl-3-(3-phenyl-1,2,4-oxadiazol-5-yl)oxan-4-amine.
| Compound Name | N-methyl-3-(3-phenyl-1,2,4-oxadiazol-5-yl)oxan-4-amine |
|---|---|
| PubChem CID | 106474300 |
| Molecular Formula | C14H17N3O2 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | N-methyl-3-(3-phenyl-1,2,4-oxadiazol-5-yl)oxan-4-amine |
| SMILES | CNC1CCOCC1c1nc(-c2ccccc2)no1 |
| InChI | InChI=1S/C14H17N3O2/c1-15-12-7-8-18-9-11(12)14-16-13(17-19-14)10-5-3-2-4-6-10/h2-6,11-12,15H,7-9H2,1H3 |
| InChIKey | VXEJVZQGAMFOLB-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |