C13H15N3O4 — CID 136888894
4-[5-[4-(methylamino)oxolan-3-yl]-1,2,4-oxadiazol-3-yl]benzene-1,2-diol (PubChem CID 136888894) has the molecular formula C13H15N3O4 and a molecular weight of 277.28 g/mol. Its IUPAC name is 4-[5-[4-(methylamino)oxolan-3-yl]-1,2,4-oxadiazol-3-yl]benzene-1,2-diol.
| Compound Name | 4-[5-[4-(methylamino)oxolan-3-yl]-1,2,4-oxadiazol-3-yl]benzene-1,2-diol |
|---|---|
| PubChem CID | 136888894 |
| Molecular Formula | C13H15N3O4 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 4-[5-[4-(methylamino)oxolan-3-yl]-1,2,4-oxadiazol-3-yl]benzene-1,2-diol |
| SMILES | CNC1COCC1c1nc(-c2ccc(O)c(O)c2)no1 |
| InChI | InChI=1S/C13H15N3O4/c1-14-9-6-19-5-8(9)13-15-12(16-20-13)7-2-3-10(17)11(18)4-7/h2-4,8-9,14,17-18H,5-6H2,1H3 |
| InChIKey | YSWNYNGYCPOSGJ-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 100.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|