C12H18N2S2 — CID 106475134
6-propyl-2-(thian-2-yl)-1H-pyrimidine-4-thione (PubChem CID 106475134) has the molecular formula C12H18N2S2 and a molecular weight of 254.42 g/mol. Its IUPAC name is 6-propyl-2-(thian-2-yl)-1H-pyrimidine-4-thione.
| Compound Name | 6-propyl-2-(thian-2-yl)-1H-pyrimidine-4-thione |
|---|---|
| PubChem CID | 106475134 |
| Molecular Formula | C12H18N2S2 |
| Molecular Weight | 254.42 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | 6-propyl-2-(thian-2-yl)-1H-pyrimidine-4-thione |
| SMILES | CCCc1cc(=S)nc(C2CCCCS2)[nH]1 |
| InChI | InChI=1S/C12H18N2S2/c1-2-5-9-8-11(15)14-12(13-9)10-6-3-4-7-16-10/h8,10H,2-7H2,1H3,(H,13,14,15) |
| InChIKey | IXVKLKUVENHTRC-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.42 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|